Modomics - A Database of RNA Modifications

Reaction details:

Reaction type level 1:
Reaction type level 2:
Reaction type level 3:
Input group: None
Output group: [O-]P(=O)(O)OC[C@@H]3O[C@H](n2cnc1c2N=C(N)NC1=O)[C@@H](O)[C@H]3O*
Introduced group name: guanylyl
Introduced group type: nucleotide
Site: phosphate
Atom address: None
Modification level: None

Enzymes that catalyse this reaction:

There are no enzymes known for this reaction

  

?
Unknown


Image with reaction

Image with reaction