Reaction details:
Reaction type level 1: |
transglycosylation |
Reaction type level 2: |
base exchange |
Reaction type level 3: |
group exchange |
Input group: |
NC2=Nc1ncnc1C(=O)N2 |
Output group: |
C1=CC(C(C1NCC2=CN(C3=C2C(=O)N=C(N3)N)C4C(C(C(O4)CO)O)O)O)O |
Introduced group name: |
Qbase |
Introduced group type: |
nucleobase |
Site: |
sugar |
Atom address: |
C1สน |
Modification level: |
0 |
Enzymes that catalyse this reaction:
There are no enzymes known for this reaction
|
|
![Image with reaction](/modomics/static/img/arrow.webp)
|