| Full name | 5-methyluridine-5'-monophosphate |
| IUPAC name | [(2R,3S,4R,5R)-3,4-dihydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl phosphate |
| Short name | pm5U |
| MODOMICS code new | 2000005551U |
| MODOMICS code | 5551U |
| Synonyms |
5-methyl-5'-O-phosphonatouridine
5-methyl-UMP CHEBI:142797 m(5)UMP TMP(2-) |
| Nature of the modified residue | Natural |
| RNAMods code | T |
| Residue unique ID | 194 |
| Found in RNA | Yes |
| Related nucleosides | 12 |
| RCSB ligands |
| Sum formula | C10H12N2O9P |
| Type of moiety | nucleotide |
| Degeneracy | not aplicable |
| SMILES | [C@H]1([n]2cc(C)c(=O)nc2=O)[C@H](O)[C@H](O)[C@@H](COP([O-])([O-])=O)O1 |
| logP | -1.0731 |
| TPSA | 169.3 |
| Number of atoms | 22 |
| Number of Hydrogen Bond Acceptors 1 (HBA1) | 9 |
| Number of Hydrogen Bond Acceptors 2 (HBA2) | 10 |
| Number of Hydrogen Bond Donors (HBD) | 2 |
| InChI | InChI=1S/C10H14N2O9P/c1-4-2-12(10(16)11-8(4)15)9-7(14)6(13)5(21-9)3-20-22(17,18)19/h2,5-7,9,13-14H,3H2,1H3,(H2,17,18,19)/p-2/t5-,6-,7-,9-/m1/s1 |
| InChIKey | SWDFLKFMJOONJB-JXOAFFINSA-L |
| Search the molecule in external databases | ChEMBL PubChem Compound Database Ligand Expo WIPO |
| PubChem CID | |
| PubChem SIDs |
* Chemical properties calculated with Open Babel - O'Boyle et al. Open Babel: An open chemical toolbox. J Cheminform 3, 33 (2011) (link)
| Dipole Magnitude [D]: | 30.078524145 |
| Energy [Eh]: | -1516.62399034791 |
| HOMO [eV]: | -8.5015 |
| LUMO [eV]: | 0.9768 |
| Gap [eV]: | 9.4783 |
| Charges | charge.txt |
| 2D | .png .mol .mol2 .sdf .pdb .smi |
| 3D | .mol .mol2 .sdf .pdb |
| Monoisotopic mass | None |
| Average mass | 335.184 |
| [M+H]+ | not available |
| Product ions | not available |
| Normalized LC elution time * | not available |
| LC elution order/characteristics | not available |
* normalized to guanosine (G), measured with a RP C-18 column with acetonitrile/ammonium acetate as mobile phase.
Last modification of this entry: Sept. 15, 2025