Reaction details:
Reaction type level 1: |
group addition |
Reaction type level 2: |
group addition |
Reaction type level 3: |
group addition |
Input group: |
*P(=O)(O)OP(=O)(O)O |
Output group: |
SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP([O-])(=O)OP([O-])(=O)OC[C@H]3O[C@@H](n2cnc1c(N)ncnc12)C(O)[C@H]3O* |
Introduced group name: |
dephospho-coenzyme A |
Introduced group type: |
other group |
Site: |
phosphate |
Atom address: |
O5'.P3 |
Modification level: |
1 |
Enzymes that catalyse this reaction:
There are no enzymes known for this reaction
|
|
![Image with reaction](/modomics/static/img/arrow.webp)
|