Modomics - A Database of RNA Modifications

Reaction details:

Reaction type level 1: 5ʹ-3ʹ guanylylation
Reaction type level 2: nucleotide addition
Reaction type level 3: group addition
Input group: OH
Output group: [O-]P(=O)(O)OC[C@@H]3O[C@H](n2cnc1c2N=C(N)NC1=O)[C@@H](O)[C@H]3O*
Introduced group name: guanylyl
Introduced group type: nucleotide
Site: phosphate
Atom address: O5'.P3
Modification level: 0

Enzymes that catalyse this reaction:

Acronym Full name Organism
Thg1 tRNA(His) guanylyltransferase Saccharomyces cerevisiae
 



Image with reaction