Reaction details:
Reaction type level 1: |
5ʹ-3ʹ guanylylation |
Reaction type level 2: |
nucleotide addition |
Reaction type level 3: |
group addition |
Input group: |
OH |
Output group: |
[O-]P(=O)(O)OC[C@@H]3O[C@H](n2cnc1c2N=C(N)NC1=O)[C@@H](O)[C@H]3O* |
Introduced group name: |
guanylyl |
Introduced group type: |
nucleotide |
Site: |
phosphate |
Atom address: |
O5'.P3 |
Modification level: |
0 |
Enzymes that catalyse this reaction:
Acronym |
Full name |
Organism |
Thg1 |
tRNA(His) guanylyltransferase |
Saccharomyces cerevisiae |
|
|

|